C32H59F9O6Si5 — CID 102070617
bis[[[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 102070617) has the molecular formula C32H59F9O6Si5 and a molecular weight of 851.23 g/mol. Its IUPAC name is bis[[[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | bis[[[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 102070617 |
| Molecular Formula | C32H59F9O6Si5 |
| Molecular Weight | 851.23 g/mol |
| Exact Mass | 850.30 |
| IUPAC Name | bis[[[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](C)(CCC1CCC2OC2C1)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(C)CCC1CCC2OC2C1 |
| InChI | InChI=1S/C32H59F9O6Si5/c1-48(2,17-12-24-8-10-26-28(22-24)42-26)44-50(5,19-14-30(33,34)35)46-52(7,21-16-32(39,40)41)47-51(6,20-15-31(36,37)38)45-49(3,4)18-13-25-9-11-27-29(23-25)43-27/h24-29H,8-23H2,1-7H3 |
| InChIKey | GXMBMJJEDOUGJI-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.23 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|