C16H40O4Si5 — CID 158590504
[dimethyl(silyl)silyl]oxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 158590504) has the molecular formula C16H40O4Si5 and a molecular weight of 436.92 g/mol. Its IUPAC name is [dimethyl(silyl)silyl]oxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | [dimethyl(silyl)silyl]oxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 158590504 |
| Molecular Formula | C16H40O4Si5 |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [dimethyl(silyl)silyl]oxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCC1CCC2OC2C1)O[Si](C)(C)[SiH3] |
| InChI | InChI=1S/C16H40O4Si5/c1-22(2,3)18-23(4,5)19-25(8,20-24(6,7)21)12-11-14-9-10-15-16(13-14)17-15/h14-16H,9-13H2,1-8,21H3 |
| InChIKey | YIZZHKPDKAEBFO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|