C24H56O8Si6 — CID 20793302
CID 20793302 (PubChem CID 20793302) has the molecular formula C24H56O8Si6 and a molecular weight of 641.22 g/mol.
| Compound Name | CID 20793302 |
|---|---|
| PubChem CID | 20793302 |
| Molecular Formula | C24H56O8Si6 |
| Molecular Weight | 641.22 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | — |
| SMILES | CCO[Si](CC[Si](C)(O[Si](C)(C)C)O[Si](C)(CCC1CCC2OC2C1)O[Si](C)(C)O[Si]C)(OCC)OCC |
| InChI | InChI=1S/C24H56O8Si6/c1-12-25-38(26-13-2,27-14-3)20-19-37(11,30-34(5,6)7)32-36(10,31-35(8,9)29-33-4)18-17-22-15-16-23-24(21-22)28-23/h22-24H,12-21H2,1-11H3 |
| InChIKey | VEFHYXQEONCIJH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.22 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|