C24H57O7Si6 — CID 20793304
CID 20793304 (PubChem CID 20793304) has the molecular formula C24H57O7Si6 and a molecular weight of 626.23 g/mol.
| Compound Name | CID 20793304 |
|---|---|
| PubChem CID | 20793304 |
| Molecular Formula | C24H57O7Si6 |
| Molecular Weight | 626.23 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | — |
| SMILES | CCO[Si](CC[Si](C)(O[Si](C)(C)C)O[Si](C)(CCC1CCC2OC2C1)O[Si](C)(C)O[Si](C)(C)C)OCC |
| InChI | InChI=1S/C24H57O7Si6/c1-13-25-32(26-14-2)18-20-37(12,29-34(6,7)8)31-36(11,30-35(9,10)28-33(3,4)5)19-17-22-15-16-23-24(21-22)27-23/h22-24H,13-21H2,1-12H3 |
| InChIKey | KJOFFDSKBHNFGI-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.23 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|