C22H44O8Si3 — CID 59882614
bis[[dimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy]-dimethylsilane (PubChem CID 59882614) has the molecular formula C22H44O8Si3 and a molecular weight of 520.84 g/mol. Its IUPAC name is bis[[dimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy]-dimethylsilane.
| Compound Name | bis[[dimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 59882614 |
| Molecular Formula | C22H44O8Si3 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | bis[[dimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy]-dimethylsilane |
| SMILES | CO[Si](CCC1CCC2OC2C1)(OC)O[Si](C)(C)O[Si](CCC1CCC2OC2C1)(OC)OC |
| InChI | InChI=1S/C22H44O8Si3/c1-23-32(24-2,13-11-17-7-9-19-21(15-17)27-19)29-31(5,6)30-33(25-3,26-4)14-12-18-8-10-20-22(16-18)28-20/h17-22H,7-16H2,1-6H3 |
| InChIKey | OQTXNUJYWLBWAW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|