C16H34O7Si2 — CID 159596149
1,2,2-trimethoxyethenylsilane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 159596149) has the molecular formula C16H34O7Si2 and a molecular weight of 394.61 g/mol. Its IUPAC name is 1,2,2-trimethoxyethenylsilane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | 1,2,2-trimethoxyethenylsilane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 159596149 |
| Molecular Formula | C16H34O7Si2 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1,2,2-trimethoxyethenylsilane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | COC([SiH3])=C(OC)OC.CO[Si](CCC1CCC2OC2C1)(OC)OC |
| InChI | InChI=1S/C11H22O4Si.C5H12O3Si/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-6-4(7-2)5(9)8-3/h9-11H,4-8H2,1-3H3;1-3,9H3 |
| InChIKey | MKWGSADUFZQQNI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|