C24H40O4Si — CID 140784911
hydroxy-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 140784911) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is hydroxy-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | hydroxy-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 140784911 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | hydroxy-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | O[Si](CCC1CCC2OC2C1)(CCC1CCC2OC2C1)CCC1CCC2OC2C1 |
| InChI | InChI=1S/C24H40O4Si/c25-29(10-7-16-1-4-19-22(13-16)26-19,11-8-17-2-5-20-23(14-17)27-20)12-9-18-3-6-21-24(15-18)28-21/h16-25H,1-15H2 |
| InChIKey | UHVRKPYDKPQEPJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|