C20H40OSi — CID 156717714
tributyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 156717714) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is tributyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | tributyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 156717714 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tributyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | CCCC[Si](CCCC)(CCCC)CCC1CCC2OC2C1 |
| InChI | InChI=1S/C20H40OSi/c1-4-7-13-22(14-8-5-2,15-9-6-3)16-12-18-10-11-19-20(17-18)21-19/h18-20H,4-17H2,1-3H3 |
| InChIKey | BBCTYBCCROYGQQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|