C20H44O7Si2 — CID 175326463
triethoxy(propyl)silane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 175326463) has the molecular formula C20H44O7Si2 and a molecular weight of 452.74 g/mol. Its IUPAC name is triethoxy(propyl)silane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | triethoxy(propyl)silane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 175326463 |
| Molecular Formula | C20H44O7Si2 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | triethoxy(propyl)silane;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.CO[Si](CCC1CCC2OC2C1)(OC)OC |
| InChI | InChI=1S/C11H22O4Si.C9H22O3Si/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-5-9-13(10-6-2,11-7-3)12-8-4/h9-11H,4-8H2,1-3H3;5-9H2,1-4H3 |
| InChIKey | ZFVRBDALVXLSOQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|