About ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate
ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate (PubChem CID 87895424) has the molecular formula C13H26O5Si
and a molecular weight of 290.43 g/mol. Its IUPAC name is ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate.
Molecular Properties
| Compound Name | ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate |
| PubChem CID | 87895424 |
| Molecular Formula | C13H26O5Si |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate |
| SMILES | CCO[Si](OC)(OC)OCCCC1CCC2OC2C1 |
| InChI | InChI=1S/C13H26O5Si/c1-4-16-19(14-2,15-3)17-9-5-6-11-7-8-12-13(10-11)18-12/h11-13H,4-10H2,1-3H3 |
| InChIKey | FUJKYTZWICFGBM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate?
The IUPAC name of ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate (CID 87895424) is ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate.
What is the SMILES notation for ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate?
The canonical SMILES for ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate is CCO[Si](OC)(OC)OCCCC1CCC2OC2C1.
What is the InChIKey of ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate?
The InChIKey is FUJKYTZWICFGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5Si/c1-4-16-19(14-2,15-3)17-9-5-6-11-7-8-12-13(10-11)18-12/h11-13H,4-10H2,1-3H3.
What are the key properties of ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate?
ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate has a molecular weight of 290.43 g/mol, XLogP of 2.12, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl dimethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propyl silicate is sourced from PubChem (CID 87895424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).