C29H50O6Si2 — CID 160590157
diethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-phenylsilane;dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 160590157) has the molecular formula C29H50O6Si2 and a molecular weight of 550.89 g/mol. Its IUPAC name is diethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-phenylsilane;dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | diethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-phenylsilane;dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 160590157 |
| Molecular Formula | C29H50O6Si2 |
| Molecular Weight | 550.89 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | diethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-phenylsilane;dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | CCO[Si](CCC1CCC2OC2C1)(OCC)c1ccccc1.CO[Si](C)(CCC1CCC2OC2C1)OC |
| InChI | InChI=1S/C18H28O3Si.C11H22O3Si/c1-3-19-22(20-4-2,16-8-6-5-7-9-16)13-12-15-10-11-17-18(14-15)21-17;1-12-15(3,13-2)7-6-9-4-5-10-11(8-9)14-10/h5-9,15,17-18H,3-4,10-14H2,1-2H3;9-11H,4-8H2,1-3H3 |
| InChIKey | RCXGBIZGILEWIW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.89 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|