C33H41NO3P2Si — CID 15397513
N,N-bis(diphenylphosphanyl)-3-triethoxysilylpropan-1-amine (PubChem CID 15397513) has the molecular formula C33H41NO3P2Si and a molecular weight of 589.73 g/mol. Its IUPAC name is N,N-bis(diphenylphosphanyl)-3-triethoxysilylpropan-1-amine.
| Compound Name | N,N-bis(diphenylphosphanyl)-3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 15397513 |
| Molecular Formula | C33H41NO3P2Si |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | N,N-bis(diphenylphosphanyl)-3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCN(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C33H41NO3P2Si/c1-4-35-40(36-5-2,37-6-3)29-19-28-34(38(30-20-11-7-12-21-30)31-22-13-8-14-23-31)39(32-24-15-9-16-25-32)33-26-17-10-18-27-33/h7-18,20-27H,4-6,19,28-29H2,1-3H3 |
| InChIKey | ROHJWUIQWDEMOT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|