C33H40BNaO4Si — CID 139829561
sodium triphenyl-[4-(3-triethoxysilylpropoxy)phenyl]boranuide (PubChem CID 139829561) has the molecular formula C33H40BNaO4Si and a molecular weight of 562.57 g/mol. Its IUPAC name is sodium triphenyl-[4-(3-triethoxysilylpropoxy)phenyl]boranuide.
| Compound Name | sodium triphenyl-[4-(3-triethoxysilylpropoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 139829561 |
| Molecular Formula | C33H40BNaO4Si |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | sodium triphenyl-[4-(3-triethoxysilylpropoxy)phenyl]boranuide |
| SMILES | CCO[Si](CCCOc1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)(OCC)OCC.[Na+] |
| InChI | InChI=1S/C33H40BO4Si.Na/c1-4-36-39(37-5-2,38-6-3)28-16-27-35-33-25-23-32(24-26-33)34(29-17-10-7-11-18-29,30-19-12-8-13-20-30)31-21-14-9-15-22-31;/h7-15,17-26H,4-6,16,27-28H2,1-3H3;/q-1;+1 |
| InChIKey | UDHMQHJCUGZIQE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|