C30H34O4PSi+ — CID 90351881
triphenyl-[4-(3-trimethoxysilylpropoxy)phenyl]phosphanium (PubChem CID 90351881) has the molecular formula C30H34O4PSi+ and a molecular weight of 517.66 g/mol. Its IUPAC name is triphenyl-[4-(3-trimethoxysilylpropoxy)phenyl]phosphanium.
| Compound Name | triphenyl-[4-(3-trimethoxysilylpropoxy)phenyl]phosphanium |
|---|---|
| PubChem CID | 90351881 |
| Molecular Formula | C30H34O4PSi+ |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | triphenyl-[4-(3-trimethoxysilylpropoxy)phenyl]phosphanium |
| SMILES | CO[Si](CCCOc1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)(OC)OC |
| InChI | InChI=1S/C30H34O4PSi/c1-31-36(32-2,33-3)25-13-24-34-26-20-22-30(23-21-26)35(27-14-7-4-8-15-27,28-16-9-5-10-17-28)29-18-11-6-12-19-29/h4-12,14-23H,13,24-25H2,1-3H3/q+1 |
| InChIKey | GQGKGEMXWRTIBC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|