C14H26O2Si2 — CID 19912171
dimethyl-(3-phenoxypropyl)-trimethylsilyloxysilane (PubChem CID 19912171) has the molecular formula C14H26O2Si2 and a molecular weight of 282.53 g/mol. Its IUPAC name is dimethyl-(3-phenoxypropyl)-trimethylsilyloxysilane.
| Compound Name | dimethyl-(3-phenoxypropyl)-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 19912171 |
| Molecular Formula | C14H26O2Si2 |
| Molecular Weight | 282.53 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | dimethyl-(3-phenoxypropyl)-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCOc1ccccc1 |
| InChI | InChI=1S/C14H26O2Si2/c1-17(2,3)16-18(4,5)13-9-12-15-14-10-7-6-8-11-14/h6-8,10-11H,9,12-13H2,1-5H3 |
| InChIKey | HPJCQIGRULIKBD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|