C20H38O5Si3 — CID 18728701
1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]phenyl]-2-hydroxy-2-methylpropan-1-one (PubChem CID 18728701) has the molecular formula C20H38O5Si3 and a molecular weight of 442.78 g/mol. Its IUPAC name is 1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]phenyl]-2-hydroxy-2-methylpropan-1-one.
| Compound Name | 1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]phenyl]-2-hydroxy-2-methylpropan-1-one |
|---|---|
| PubChem CID | 18728701 |
| Molecular Formula | C20H38O5Si3 |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]phenyl]-2-hydroxy-2-methylpropan-1-one |
| SMILES | CC(C)(O)C(=O)c1ccc(OCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H38O5Si3/c1-20(2,22)19(21)17-11-13-18(14-12-17)23-15-10-16-27(6,7)25-28(8,9)24-26(3,4)5/h11-14,22H,10,15-16H2,1-9H3 |
| InChIKey | ZPURKDRIECKDPI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|