C18H30O2Si2 — CID 132596423
5-(4-ethynylphenoxy)pentyl-dimethyl-trimethylsilyloxysilane (PubChem CID 132596423) has the molecular formula C18H30O2Si2 and a molecular weight of 334.61 g/mol. Its IUPAC name is 5-(4-ethynylphenoxy)pentyl-dimethyl-trimethylsilyloxysilane.
| Compound Name | 5-(4-ethynylphenoxy)pentyl-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 132596423 |
| Molecular Formula | C18H30O2Si2 |
| Molecular Weight | 334.61 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 5-(4-ethynylphenoxy)pentyl-dimethyl-trimethylsilyloxysilane |
| SMILES | C#Cc1ccc(OCCCCC[Si](C)(C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H30O2Si2/c1-7-17-11-13-18(14-12-17)19-15-9-8-10-16-22(5,6)20-21(2,3)4/h1,11-14H,8-10,15-16H2,2-6H3 |
| InChIKey | SCNFVKVCXSTPGH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|