C19H24O6Si — CID 20509689
[3-(3-trimethoxysilylpropoxy)phenyl] benzoate (PubChem CID 20509689) has the molecular formula C19H24O6Si and a molecular weight of 376.48 g/mol. Its IUPAC name is [3-(3-trimethoxysilylpropoxy)phenyl] benzoate.
| Compound Name | [3-(3-trimethoxysilylpropoxy)phenyl] benzoate |
|---|---|
| PubChem CID | 20509689 |
| Molecular Formula | C19H24O6Si |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [3-(3-trimethoxysilylpropoxy)phenyl] benzoate |
| SMILES | CO[Si](CCCOc1cccc(OC(=O)c2ccccc2)c1)(OC)OC |
| InChI | InChI=1S/C19H24O6Si/c1-21-26(22-2,23-3)14-8-13-24-17-11-7-12-18(15-17)25-19(20)16-9-5-4-6-10-16/h4-7,9-12,15H,8,13-14H2,1-3H3 |
| InChIKey | DGGQHFVSFIFYNB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|