C22H30O6Si — CID 52911417
[3-(3-triethoxysilylpropoxy)phenyl] benzoate (PubChem CID 52911417) has the molecular formula C22H30O6Si and a molecular weight of 418.56 g/mol. Its IUPAC name is [3-(3-triethoxysilylpropoxy)phenyl] benzoate.
| Compound Name | [3-(3-triethoxysilylpropoxy)phenyl] benzoate |
|---|---|
| PubChem CID | 52911417 |
| Molecular Formula | C22H30O6Si |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [3-(3-triethoxysilylpropoxy)phenyl] benzoate |
| SMILES | CCO[Si](CCCOc1cccc(OC(=O)c2ccccc2)c1)(OCC)OCC |
| InChI | InChI=1S/C22H30O6Si/c1-4-25-29(26-5-2,27-6-3)17-11-16-24-20-14-10-15-21(18-20)28-22(23)19-12-8-7-9-13-19/h7-10,12-15,18H,4-6,11,16-17H2,1-3H3 |
| InChIKey | PZEJHCJICPCSMC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|