C34H34F6OP+ — CID 158233367
[3,5-bis(trifluoromethyl)phenyl]-(4-octoxyphenyl)-diphenylphosphanium (PubChem CID 158233367) has the molecular formula C34H34F6OP+ and a molecular weight of 603.61 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-(4-octoxyphenyl)-diphenylphosphanium.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-(4-octoxyphenyl)-diphenylphosphanium |
|---|---|
| PubChem CID | 158233367 |
| Molecular Formula | C34H34F6OP+ |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-(4-octoxyphenyl)-diphenylphosphanium |
| SMILES | CCCCCCCCOc1ccc([P+](c2ccccc2)(c2ccccc2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C34H34F6OP/c1-2-3-4-5-6-13-22-41-28-18-20-31(21-19-28)42(29-14-9-7-10-15-29,30-16-11-8-12-17-30)32-24-26(33(35,36)37)23-27(25-32)34(38,39)40/h7-12,14-21,23-25H,2-6,13,22H2,1H3/q+1 |
| InChIKey | SHLXWBQJIGIWHK-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|