C46H60N2O7PSi2+ — CID 102511384
diphenyl-[(4-triethoxysilylphenyl)methyl]-[4-[[4-(3-triethoxysilylpropoxy)phenyl]diazenyl]phenyl]phosphanium (PubChem CID 102511384) has the molecular formula C46H60N2O7PSi2+ and a molecular weight of 840.14 g/mol. Its IUPAC name is diphenyl-[(4-triethoxysilylphenyl)methyl]-[4-[[4-(3-triethoxysilylpropoxy)phenyl]diazenyl]phenyl]phosphanium.
| Compound Name | diphenyl-[(4-triethoxysilylphenyl)methyl]-[4-[[4-(3-triethoxysilylpropoxy)phenyl]diazenyl]phenyl]phosphanium |
|---|---|
| PubChem CID | 102511384 |
| Molecular Formula | C46H60N2O7PSi2+ |
| Molecular Weight | 840.14 g/mol |
| Exact Mass | 839.37 |
| IUPAC Name | diphenyl-[(4-triethoxysilylphenyl)methyl]-[4-[[4-(3-triethoxysilylpropoxy)phenyl]diazenyl]phenyl]phosphanium |
| SMILES | CCO[Si](CCCOc1ccc(/N=N/c2ccc([P+](Cc3ccc([Si](OCC)(OCC)OCC)cc3)(c3ccccc3)c3ccccc3)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C46H60N2O7PSi2/c1-7-50-57(51-8-2,52-9-3)37-19-36-49-42-30-26-40(27-31-42)47-48-41-28-32-45(33-29-41)56(43-20-15-13-16-21-43,44-22-17-14-18-23-44)38-39-24-34-46(35-25-39)58(53-10-4,54-11-5)55-12-6/h13-18,20-35H,7-12,19,36-38H2,1-6H3/q+1/b48-47+ |
| InChIKey | JDYKNRBQUFWWOY-QJGAVIKSSA-N |
| XLogP | 9.67 |
| TPSA | 89.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.14 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|