C21H30N2O4Si — CID 102598751
1-pyridin-2-yl-N-[4-(3-triethoxysilylpropoxy)phenyl]methanimine (PubChem CID 102598751) has the molecular formula C21H30N2O4Si and a molecular weight of 402.57 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-[4-(3-triethoxysilylpropoxy)phenyl]methanimine.
| Compound Name | 1-pyridin-2-yl-N-[4-(3-triethoxysilylpropoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 102598751 |
| Molecular Formula | C21H30N2O4Si |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1-pyridin-2-yl-N-[4-(3-triethoxysilylpropoxy)phenyl]methanimine |
| SMILES | CCO[Si](CCCOc1ccc(/N=C/c2ccccn2)cc1)(OCC)OCC |
| InChI | InChI=1S/C21H30N2O4Si/c1-4-25-28(26-5-2,27-6-3)17-9-16-24-21-13-11-19(12-14-21)23-18-20-10-7-8-15-22-20/h7-8,10-15,18H,4-6,9,16-17H2,1-3H3/b23-18+ |
| InChIKey | QNDAQELOYHFXEC-PTGBLXJZSA-N |
| XLogP | 4.65 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|