C14H22HgO6Si — CID 23265876
acetyloxy-[4-(3-trimethoxysilylpropoxy)phenyl]mercury (PubChem CID 23265876) has the molecular formula C14H22HgO6Si and a molecular weight of 515.00 g/mol. Its IUPAC name is acetyloxy-[4-(3-trimethoxysilylpropoxy)phenyl]mercury.
| Compound Name | acetyloxy-[4-(3-trimethoxysilylpropoxy)phenyl]mercury |
|---|---|
| PubChem CID | 23265876 |
| Molecular Formula | C14H22HgO6Si |
| Molecular Weight | 515.00 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | acetyloxy-[4-(3-trimethoxysilylpropoxy)phenyl]mercury |
| SMILES | CO[Si](CCCOc1ccc([Hg]OC(C)=O)cc1)(OC)OC |
| InChI | InChI=1S/C12H19O4Si.C2H4O2.Hg/c1-13-17(14-2,15-3)11-7-10-16-12-8-5-4-6-9-12;1-2(3)4;/h5-6,8-9H,7,10-11H2,1-3H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | QKIWNQWAODQZKT-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.00 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|