C39H66O7Si — CID 91075767
triethoxy-[3-[4-[4-[10-[2-ethyl-2-(methoxymethyl)butoxy]decoxy]phenyl]phenoxy]propyl]silane (PubChem CID 91075767) has the molecular formula C39H66O7Si and a molecular weight of 675.04 g/mol. Its IUPAC name is triethoxy-[3-[4-[4-[10-[2-ethyl-2-(methoxymethyl)butoxy]decoxy]phenyl]phenoxy]propyl]silane.
| Compound Name | triethoxy-[3-[4-[4-[10-[2-ethyl-2-(methoxymethyl)butoxy]decoxy]phenyl]phenoxy]propyl]silane |
|---|---|
| PubChem CID | 91075767 |
| Molecular Formula | C39H66O7Si |
| Molecular Weight | 675.04 g/mol |
| Exact Mass | 674.46 |
| IUPAC Name | triethoxy-[3-[4-[4-[10-[2-ethyl-2-(methoxymethyl)butoxy]decoxy]phenyl]phenoxy]propyl]silane |
| SMILES | CCO[Si](CCCOc1ccc(-c2ccc(OCCCCCCCCCCOCC(CC)(CC)COC)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C39H66O7Si/c1-7-39(8-2,33-40-6)34-41-29-18-16-14-12-13-15-17-19-30-42-37-25-21-35(22-26-37)36-23-27-38(28-24-36)43-31-20-32-47(44-9-3,45-10-4)46-11-5/h21-28H,7-20,29-34H2,1-6H3 |
| InChIKey | KJIKSFVQTLAPMG-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.04 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|