C48H84O12Si2 — CID 91192068
triethoxy-[3-[2-methyl-2-[8-[4-[4-[(3-methyloxetan-3-yl)methoxy]phenyl]phenoxy]octoxymethyl]-3-(3-triethoxysilylpropoxy)propoxy]propyl]silane (PubChem CID 91192068) has the molecular formula C48H84O12Si2 and a molecular weight of 909.36 g/mol. Its IUPAC name is triethoxy-[3-[2-methyl-2-[8-[4-[4-[(3-methyloxetan-3-yl)methoxy]phenyl]phenoxy]octoxymethyl]-3-(3-triethoxysilylpropoxy)propoxy]propyl]silane.
| Compound Name | triethoxy-[3-[2-methyl-2-[8-[4-[4-[(3-methyloxetan-3-yl)methoxy]phenyl]phenoxy]octoxymethyl]-3-(3-triethoxysilylpropoxy)propoxy]propyl]silane |
|---|---|
| PubChem CID | 91192068 |
| Molecular Formula | C48H84O12Si2 |
| Molecular Weight | 909.36 g/mol |
| Exact Mass | 908.55 |
| IUPAC Name | triethoxy-[3-[2-methyl-2-[8-[4-[4-[(3-methyloxetan-3-yl)methoxy]phenyl]phenoxy]octoxymethyl]-3-(3-triethoxysilylpropoxy)propoxy]propyl]silane |
| SMILES | CCO[Si](CCCOCC(C)(COCCCCCCCCOc1ccc(-c2ccc(OCC3(C)COC3)cc2)cc1)COCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C48H84O12Si2/c1-9-55-61(56-10-2,57-11-3)35-21-32-50-38-47(7,39-51-33-22-36-62(58-12-4,59-13-5)60-14-6)37-49-31-19-17-15-16-18-20-34-53-45-27-23-43(24-28-45)44-25-29-46(30-26-44)54-42-48(8)40-52-41-48/h23-30H,9-22,31-42H2,1-8H3 |
| InChIKey | KDCSQWRTMZMJCP-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.36 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|