C35H42O6 — CID 101196540
3-[[4-[1,1-bis[4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-methyloxetane (PubChem CID 101196540) has the molecular formula C35H42O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is 3-[[4-[1,1-bis[4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-methyloxetane.
| Compound Name | 3-[[4-[1,1-bis[4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-methyloxetane |
|---|---|
| PubChem CID | 101196540 |
| Molecular Formula | C35H42O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 3-[[4-[1,1-bis[4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-methyloxetane |
| SMILES | CC1(COc2ccc(C(C)(c3ccc(OCC4(C)COC4)cc3)c3ccc(OCC4(C)COC4)cc3)cc2)COC1 |
| InChI | InChI=1S/C35H42O6/c1-32(17-36-18-32)23-39-29-11-5-26(6-12-29)35(4,27-7-13-30(14-8-27)40-24-33(2)19-37-20-33)28-9-15-31(16-10-28)41-25-34(3)21-38-22-34/h5-16H,17-25H2,1-4H3 |
| InChIKey | JYXRKXQUIZHWSI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|