C35H37I5O6 — CID 176676168
3-[[4-[1,1-bis[3,5-diiodo-4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]-2-iodophenoxy]methyl]-3-methyloxetane (PubChem CID 176676168) has the molecular formula C35H37I5O6 and a molecular weight of 1188.19 g/mol. Its IUPAC name is 3-[[4-[1,1-bis[3,5-diiodo-4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]-2-iodophenoxy]methyl]-3-methyloxetane.
| Compound Name | 3-[[4-[1,1-bis[3,5-diiodo-4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]-2-iodophenoxy]methyl]-3-methyloxetane |
|---|---|
| PubChem CID | 176676168 |
| Molecular Formula | C35H37I5O6 |
| Molecular Weight | 1188.19 g/mol |
| Exact Mass | 1187.78 |
| IUPAC Name | 3-[[4-[1,1-bis[3,5-diiodo-4-[(3-methyloxetan-3-yl)methoxy]phenyl]ethyl]-2-iodophenoxy]methyl]-3-methyloxetane |
| SMILES | CC1(COc2ccc(C(C)(c3cc(I)c(OCC4(C)COC4)c(I)c3)c3cc(I)c(OCC4(C)COC4)c(I)c3)cc2I)COC1 |
| InChI | InChI=1S/C35H37I5O6/c1-32(12-41-13-32)18-44-29-6-5-21(7-24(29)36)35(4,22-8-25(37)30(26(38)9-22)45-19-33(2)14-42-15-33)23-10-27(39)31(28(40)11-23)46-20-34(3)16-43-17-34/h5-11H,12-20H2,1-4H3 |
| InChIKey | WWHWFAYMJKNCJK-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1188.19 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|