C28H26I6O5 — CID 176676194
4-[1-[3,5-diiodo-4-[2-(oxiran-2-yl)ethoxy]phenyl]-1-(4-ethoxy-3,5-diiodophenyl)ethyl]-2,6-diiodophenol;oxirane (PubChem CID 176676194) has the molecular formula C28H26I6O5 and a molecular weight of 1203.93 g/mol. Its IUPAC name is 4-[1-[3,5-diiodo-4-[2-(oxiran-2-yl)ethoxy]phenyl]-1-(4-ethoxy-3,5-diiodophenyl)ethyl]-2,6-diiodophenol;oxirane.
| Compound Name | 4-[1-[3,5-diiodo-4-[2-(oxiran-2-yl)ethoxy]phenyl]-1-(4-ethoxy-3,5-diiodophenyl)ethyl]-2,6-diiodophenol;oxirane |
|---|---|
| PubChem CID | 176676194 |
| Molecular Formula | C28H26I6O5 |
| Molecular Weight | 1203.93 g/mol |
| Exact Mass | 1203.60 |
| IUPAC Name | 4-[1-[3,5-diiodo-4-[2-(oxiran-2-yl)ethoxy]phenyl]-1-(4-ethoxy-3,5-diiodophenyl)ethyl]-2,6-diiodophenol;oxirane |
| SMILES | C1CO1.CCOc1c(I)cc(C(C)(c2cc(I)c(O)c(I)c2)c2cc(I)c(OCCC3CO3)c(I)c2)cc1I |
| InChI | InChI=1S/C26H22I6O4.C2H4O/c1-3-34-24-19(29)8-14(9-20(24)30)26(2,13-6-17(27)23(33)18(28)7-13)15-10-21(31)25(22(32)11-15)35-5-4-16-12-36-16;1-2-3-1/h6-11,16,33H,3-5,12H2,1-2H3;1-2H2 |
| InChIKey | CFUJYEPLQKBJFX-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1203.93 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|