C39H60O4 — CID 87442540
2-[2-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-(oxiran-2-yl)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl]oxirane (PubChem CID 87442540) has the molecular formula C39H60O4 and a molecular weight of 592.90 g/mol. Its IUPAC name is 2-[2-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-(oxiran-2-yl)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl]oxirane.
| Compound Name | 2-[2-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-(oxiran-2-yl)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl]oxirane |
|---|---|
| PubChem CID | 87442540 |
| Molecular Formula | C39H60O4 |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.45 |
| IUPAC Name | 2-[2-[2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-(oxiran-2-yl)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl]oxirane |
| SMILES | CC(C)(C)c1cc(C(C)(C)c2cc(C(C)(C)C)c(OCCC3CO3)c(C(C)(C)C)c2)cc(C(C)(C)C)c1OCCC1CO1 |
| InChI | InChI=1S/C39H60O4/c1-35(2,3)29-19-25(20-30(36(4,5)6)33(29)40-17-15-27-23-42-27)39(13,14)26-21-31(37(7,8)9)34(32(22-26)38(10,11)12)41-18-16-28-24-43-28/h19-22,27-28H,15-18,23-24H2,1-14H3 |
| InChIKey | IHQSOWFAXMSPES-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|