C17H26O4 — CID 160629568
(3-ethyloxetan-3-yl)methanol;3-methyl-3-(phenoxymethyl)oxetane (PubChem CID 160629568) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3-ethyloxetan-3-yl)methanol;3-methyl-3-(phenoxymethyl)oxetane.
| Compound Name | (3-ethyloxetan-3-yl)methanol;3-methyl-3-(phenoxymethyl)oxetane |
|---|---|
| PubChem CID | 160629568 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (3-ethyloxetan-3-yl)methanol;3-methyl-3-(phenoxymethyl)oxetane |
| SMILES | CC1(COc2ccccc2)COC1.CCC1(CO)COC1 |
| InChI | InChI=1S/C11H14O2.C6H12O2/c1-11(7-12-8-11)9-13-10-5-3-2-4-6-10;1-2-6(3-7)4-8-5-6/h2-6H,7-9H2,1H3;7H,2-5H2,1H3 |
| InChIKey | RHTBQHHYROWCGY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |