C11H13BO3 — CID 142556210
CID 142556210 (PubChem CID 142556210) has the molecular formula C11H13BO3 and a molecular weight of 204.03 g/mol.
| Compound Name | CID 142556210 |
|---|---|
| PubChem CID | 142556210 |
| Molecular Formula | C11H13BO3 |
| Molecular Weight | 204.03 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(OCC2(CO)COC2)cc1 |
| InChI | InChI=1S/C11H13BO3/c12-9-1-3-10(4-2-9)15-8-11(5-13)6-14-7-11/h1-4,13H,5-8H2 |
| InChIKey | IVFYNGDEPACAOB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.03 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|