C32H52O6SSi — CID 91319392
3-[4-[4-[8-(3-triethoxysilylpropoxy)octoxy]phenyl]phenoxy]propane-1-thiol (PubChem CID 91319392) has the molecular formula C32H52O6SSi and a molecular weight of 592.92 g/mol. Its IUPAC name is 3-[4-[4-[8-(3-triethoxysilylpropoxy)octoxy]phenyl]phenoxy]propane-1-thiol.
| Compound Name | 3-[4-[4-[8-(3-triethoxysilylpropoxy)octoxy]phenyl]phenoxy]propane-1-thiol |
|---|---|
| PubChem CID | 91319392 |
| Molecular Formula | C32H52O6SSi |
| Molecular Weight | 592.92 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 3-[4-[4-[8-(3-triethoxysilylpropoxy)octoxy]phenyl]phenoxy]propane-1-thiol |
| SMILES | CCO[Si](CCCOCCCCCCCCOc1ccc(-c2ccc(OCCCS)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C32H52O6SSi/c1-4-36-40(37-5-2,38-6-3)28-14-24-33-23-11-9-7-8-10-12-25-34-31-19-15-29(16-20-31)30-17-21-32(22-18-30)35-26-13-27-39/h15-22,39H,4-14,23-28H2,1-3H3 |
| InChIKey | BJPINNVJZKZGOK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.92 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|