C15H23Hf- — CID 159836461
1-butylcyclopenta-1,3-diene;2,3-dimethylbuta-1,3-diene;hafnium (PubChem CID 159836461) has the molecular formula C15H23Hf- and a molecular weight of 381.84 g/mol. Its IUPAC name is 1-butylcyclopenta-1,3-diene;2,3-dimethylbuta-1,3-diene;hafnium.
| Compound Name | 1-butylcyclopenta-1,3-diene;2,3-dimethylbuta-1,3-diene;hafnium |
|---|---|
| PubChem CID | 159836461 |
| Molecular Formula | C15H23Hf- |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-butylcyclopenta-1,3-diene;2,3-dimethylbuta-1,3-diene;hafnium |
| SMILES | C=C(C)C(=C)C.CCCCc1ccc[cH-]1.[Hf] |
| InChI | InChI=1S/C9H13.C6H10.Hf/c1-2-3-6-9-7-4-5-8-9;1-5(2)6(3)4;/h4-5,7-8H,2-3,6H2,1H3;1,3H2,2,4H3;/q-1;; |
| InChIKey | CRMMHUCPASPJQG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|