About 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+)
1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) (PubChem CID 15818168) has the molecular formula C14H18Fe
and a molecular weight of 242.14 g/mol. Its IUPAC name is 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+).
Molecular Properties
| Compound Name | 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
| PubChem CID | 15818168 |
| Molecular Formula | C14H18Fe |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CCCCc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H13.C5H5.Fe/c1-2-3-6-9-7-4-5-8-9;1-2-4-5-3-1;/h4-5,7-8H,2-3,6H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | WFUDBPZFGCNRDM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+)?
The IUPAC name of 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) (CID 15818168) is 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+).
What is the SMILES notation for 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+)?
The canonical SMILES for 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) is CCCCc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1.
What is the InChIKey of 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+)?
The InChIKey is WFUDBPZFGCNRDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13.C5H5.Fe/c1-2-3-6-9-7-4-5-8-9;1-2-4-5-3-1;/h4-5,7-8H,2-3,6H2,1H3;1-5H;/q2*-1;+2.
What are the key properties of 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+)?
1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) has a molecular weight of 242.14 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) is sourced from PubChem (CID 15818168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).