C14H19FeN — CID 159037624
N-butylcyclopenta-1,3-dien-1-amine;cyclopenta-1,3-diene;iron(2+) (PubChem CID 159037624) has the molecular formula C14H19FeN and a molecular weight of 257.16 g/mol. Its IUPAC name is N-butylcyclopenta-1,3-dien-1-amine;cyclopenta-1,3-diene;iron(2+).
| Compound Name | N-butylcyclopenta-1,3-dien-1-amine;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 159037624 |
| Molecular Formula | C14H19FeN |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-butylcyclopenta-1,3-dien-1-amine;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CCCCNc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H14N.C5H5.Fe/c1-2-3-8-10-9-6-4-5-7-9;1-2-4-5-3-1;/h4-7,10H,2-3,8H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | JVQPJDLBJCHPKD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|