C40H40FeP2 — CID 159314946
bis(3-cyclopenta-1,3-dien-1-ylpropyl(diphenyl)phosphane);iron(2+) (PubChem CID 159314946) has the molecular formula C40H40FeP2 and a molecular weight of 638.55 g/mol. Its IUPAC name is bis(3-cyclopenta-1,3-dien-1-ylpropyl(diphenyl)phosphane);iron(2+).
| Compound Name | bis(3-cyclopenta-1,3-dien-1-ylpropyl(diphenyl)phosphane);iron(2+) |
|---|---|
| PubChem CID | 159314946 |
| Molecular Formula | C40H40FeP2 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | bis(3-cyclopenta-1,3-dien-1-ylpropyl(diphenyl)phosphane);iron(2+) |
| SMILES | [Fe+2].c1ccc(P(CCCc2ccc[cH-]2)c2ccccc2)cc1.c1ccc(P(CCCc2ccc[cH-]2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C20H20P.Fe/c2*1-3-13-19(14-4-1)21(20-15-5-2-6-16-20)17-9-12-18-10-7-8-11-18;/h2*1-8,10-11,13-16H,9,12,17H2;/q2*-1;+2 |
| InChIKey | LDACHKPOUGEIBN-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|