C12H6FeO2-6 — CID 42619041
cyclopenta-2,4-diene-1-carbaldehyde;cyclopenta-2,4-diene-1-carbaldehyde;iron (PubChem CID 42619041) has the molecular formula C12H6FeO2-6 and a molecular weight of 238.02 g/mol. Its IUPAC name is cyclopenta-2,4-diene-1-carbaldehyde;cyclopenta-2,4-diene-1-carbaldehyde;iron.
| Compound Name | cyclopenta-2,4-diene-1-carbaldehyde;cyclopenta-2,4-diene-1-carbaldehyde;iron |
|---|---|
| PubChem CID | 42619041 |
| Molecular Formula | C12H6FeO2-6 |
| Molecular Weight | 238.02 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | cyclopenta-2,4-diene-1-carbaldehyde;cyclopenta-2,4-diene-1-carbaldehyde;iron |
| SMILES | O=C[c-]1[c-][c-][c-][c-]1.O=C[c-]1cccc1.[Fe] |
| InChI | InChI=1S/C6H5O.C6HO.Fe/c2*7-5-6-3-1-2-4-6;/h1-5H;5H;/q-1;-5; |
| InChIKey | QYYMHDSUILPNMZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.02 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|