1,4-dichlorobenzene;formyl chloride

C7H5Cl3O — CID 174264230

IUPAC1,4-dichlorobenzene;formyl chloride
SMILESClc1ccc(Cl)cc1.O=CCl
InChIInChI=1S/C6H4Cl2.CHClO/c7-5-1-2-6(8)4-3-5;2-1-3/h1-4H;1H
InChIKeyXBDGGUAIVRYOMI-UHFFFAOYSA-N
MW211.48 g/mol
LogP3.41
Rot. Bonds

About 1,4-dichlorobenzene;formyl chloride

1,4-dichlorobenzene;formyl chloride (PubChem CID 174264230) has the molecular formula C7H5Cl3O and a molecular weight of 211.48 g/mol. Its IUPAC name is 1,4-dichlorobenzene;formyl chloride.

Molecular Properties

Compound Name1,4-dichlorobenzene;formyl chloride
PubChem CID174264230
Molecular FormulaC7H5Cl3O
Molecular Weight211.48 g/mol
Exact Mass209.94
IUPAC Name1,4-dichlorobenzene;formyl chloride
SMILESClc1ccc(Cl)cc1.O=CCl
InChIInChI=1S/C6H4Cl2.CHClO/c7-5-1-2-6(8)4-3-5;2-1-3/h1-4H;1H
InChIKeyXBDGGUAIVRYOMI-UHFFFAOYSA-N
XLogP3.41
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.48
LogP ≤ 53.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 1,4-dichlorobenzene;formyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dichlorobenzene;formyl chloride?
The IUPAC name of 1,4-dichlorobenzene;formyl chloride (CID 174264230) is 1,4-dichlorobenzene;formyl chloride.
What is the SMILES notation for 1,4-dichlorobenzene;formyl chloride?
The canonical SMILES for 1,4-dichlorobenzene;formyl chloride is Clc1ccc(Cl)cc1.O=CCl.
What is the InChIKey of 1,4-dichlorobenzene;formyl chloride?
The InChIKey is XBDGGUAIVRYOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.CHClO/c7-5-1-2-6(8)4-3-5;2-1-3/h1-4H;1H.
What are the key properties of 1,4-dichlorobenzene;formyl chloride?
1,4-dichlorobenzene;formyl chloride has a molecular weight of 211.48 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichlorobenzene;formyl chloride is sourced from PubChem (CID 174264230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).