About bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron
bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron (PubChem CID 173240682) has the molecular formula C19H15BrFeO-6
and a molecular weight of 395.08 g/mol. Its IUPAC name is bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron.
Molecular Properties
| Compound Name | bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron |
| PubChem CID | 173240682 |
| Molecular Formula | C19H15BrFeO-6 |
| Molecular Weight | 395.08 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron |
| SMILES | Br[c-]1[cH-][cH-][cH-][cH-]1.O=C(C=C[c-]1cccc1)c1ccccc1.[Fe] |
| InChI | InChI=1S/C14H11O.C5H4Br.Fe/c15-14(13-8-2-1-3-9-13)11-10-12-6-4-5-7-12;6-5-3-1-2-4-5;/h1-11H;1-4H;/q-1;-5; |
| InChIKey | XNFAMFKOTREGST-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.08 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron?
The IUPAC name of bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron (CID 173240682) is bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron.
What is the SMILES notation for bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron?
The canonical SMILES for bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron is Br[c-]1[cH-][cH-][cH-][cH-]1.O=C(C=C[c-]1cccc1)c1ccccc1.[Fe].
What is the InChIKey of bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron?
The InChIKey is XNFAMFKOTREGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11O.C5H4Br.Fe/c15-14(13-8-2-1-3-9-13)11-10-12-6-4-5-7-12;6-5-3-1-2-4-5;/h1-11H;1-4H;/q-1;-5;.
What are the key properties of bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron?
bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron has a molecular weight of 395.08 g/mol, XLogP of 5.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromocyclopentane;3-cyclopenta-2,4-dien-1-yl-1-phenylprop-2-en-1-one;iron is sourced from PubChem (CID 173240682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).