C15H13ClO3 — CID 69039311
3-(2,3-dihydroxyphenyl)-1-phenylprop-2-en-1-one;hydrochloride (PubChem CID 69039311) has the molecular formula C15H13ClO3 and a molecular weight of 276.72 g/mol. Its IUPAC name is 3-(2,3-dihydroxyphenyl)-1-phenylprop-2-en-1-one;hydrochloride.
| Compound Name | 3-(2,3-dihydroxyphenyl)-1-phenylprop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 69039311 |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-(2,3-dihydroxyphenyl)-1-phenylprop-2-en-1-one;hydrochloride |
| SMILES | Cl.O=C(C=Cc1cccc(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C15H12O3.ClH/c16-13(11-5-2-1-3-6-11)10-9-12-7-4-8-14(17)15(12)18;/h1-10,17-18H;1H |
| InChIKey | ZUHZPTRDDPDNIR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|