C18H18O5 — CID 141120991
3-(5-hydroxy-2,3,4-trimethoxyphenyl)-1-phenylprop-2-en-1-one (PubChem CID 141120991) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-(5-hydroxy-2,3,4-trimethoxyphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | 3-(5-hydroxy-2,3,4-trimethoxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 141120991 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-(5-hydroxy-2,3,4-trimethoxyphenyl)-1-phenylprop-2-en-1-one |
| SMILES | COc1c(O)cc(C=CC(=O)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C18H18O5/c1-21-16-13(11-15(20)17(22-2)18(16)23-3)9-10-14(19)12-7-5-4-6-8-12/h4-11,20H,1-3H3 |
| InChIKey | MQNFNZXOWOGBSM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|