C15H12O4 — CID 146448432
(E)-1-phenyl-3-(2,4,5-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 146448432) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is (E)-1-phenyl-3-(2,4,5-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-phenyl-3-(2,4,5-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 146448432 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (E)-1-phenyl-3-(2,4,5-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(O)c(O)cc1O)c1ccccc1 |
| InChI | InChI=1S/C15H12O4/c16-12(10-4-2-1-3-5-10)7-6-11-8-14(18)15(19)9-13(11)17/h1-9,17-19H/b7-6+ |
| InChIKey | IVRNWCOIWPBNQV-VOTSOKGWSA-N |
| XLogP | 2.70 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|