C7H10Ru — CID 141259751
cyclopenta-1,3-diene;ethane;ruthenium(2+) (PubChem CID 141259751) has the molecular formula C7H10Ru and a molecular weight of 195.23 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ethane;ruthenium(2+).
| Compound Name | cyclopenta-1,3-diene;ethane;ruthenium(2+) |
|---|---|
| PubChem CID | 141259751 |
| Molecular Formula | C7H10Ru |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | cyclopenta-1,3-diene;ethane;ruthenium(2+) |
| SMILES | [CH2-]C.[Ru+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C5H5.C2H5.Ru/c1-2-4-5-3-1;1-2;/h1-5H;1H2,2H3;/q2*-1;+2 |
| InChIKey | OTOFYRBIMUMSNO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|