About cyclopenta-1,3-diene;tetramethylazanium
cyclopenta-1,3-diene;tetramethylazanium (PubChem CID 134880327) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is cyclopenta-1,3-diene;tetramethylazanium.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;tetramethylazanium |
| PubChem CID | 134880327 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | cyclopenta-1,3-diene;tetramethylazanium |
| SMILES | C[N+](C)(C)C.c1cc[cH-]c1 |
| InChI | InChI=1S/C5H5.C4H12N/c1-2-4-5-3-1;1-5(2,3)4/h1-5H;1-4H3/q-1;+1 |
| InChIKey | LUFWWAHXVACZMO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;tetramethylazanium?
The IUPAC name of cyclopenta-1,3-diene;tetramethylazanium (CID 134880327) is cyclopenta-1,3-diene;tetramethylazanium.
What is the SMILES notation for cyclopenta-1,3-diene;tetramethylazanium?
The canonical SMILES for cyclopenta-1,3-diene;tetramethylazanium is C[N+](C)(C)C.c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;tetramethylazanium?
The InChIKey is LUFWWAHXVACZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5.C4H12N/c1-2-4-5-3-1;1-5(2,3)4/h1-5H;1-4H3/q-1;+1.
What are the key properties of cyclopenta-1,3-diene;tetramethylazanium?
cyclopenta-1,3-diene;tetramethylazanium has a molecular weight of 139.24 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;tetramethylazanium is sourced from PubChem (CID 134880327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).