About cyclopenta-1,3-diene;cyclopentane;tantalum dihydride
cyclopenta-1,3-diene;cyclopentane;tantalum dihydride (PubChem CID 11984734) has the molecular formula C10H10Ta-6
and a molecular weight of 311.14 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopentane;tantalum dihydride.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;cyclopentane;tantalum dihydride |
| PubChem CID | 11984734 |
| Molecular Formula | C10H10Ta-6 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopentane;tantalum dihydride |
| SMILES | [Ta].[cH-]1[cH-][cH-][cH-][cH-]1.c1cc[cH-]c1 |
| InChI | InChI=1S/2C5H5.Ta/c2*1-2-4-5-3-1;/h2*1-5H;/q-5;-1; |
| InChIKey | MGGKKRQJFYZLJJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;cyclopentane;tantalum dihydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;cyclopentane;tantalum dihydride?
The IUPAC name of cyclopenta-1,3-diene;cyclopentane;tantalum dihydride (CID 11984734) is cyclopenta-1,3-diene;cyclopentane;tantalum dihydride.
What is the SMILES notation for cyclopenta-1,3-diene;cyclopentane;tantalum dihydride?
The canonical SMILES for cyclopenta-1,3-diene;cyclopentane;tantalum dihydride is [Ta].[cH-]1[cH-][cH-][cH-][cH-]1.c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;cyclopentane;tantalum dihydride?
The InChIKey is MGGKKRQJFYZLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Ta/c2*1-2-4-5-3-1;/h2*1-5H;/q-5;-1;.
What are the key properties of cyclopenta-1,3-diene;cyclopentane;tantalum dihydride?
cyclopenta-1,3-diene;cyclopentane;tantalum dihydride has a molecular weight of 311.14 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;cyclopentane;tantalum dihydride is sourced from PubChem (CID 11984734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).