C16H22Fe — CID 162248529
cyclopenta-1,3-diene;iron(2+);1,2,5-triethylcyclopenta-1,3-diene (PubChem CID 162248529) has the molecular formula C16H22Fe and a molecular weight of 270.20 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);1,2,5-triethylcyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,3-diene;iron(2+);1,2,5-triethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 162248529 |
| Molecular Formula | C16H22Fe |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);1,2,5-triethylcyclopenta-1,3-diene |
| SMILES | CCc1cc[c-](CC)c1CC.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C11H17.C5H5.Fe/c1-4-9-7-8-10(5-2)11(9)6-3;1-2-4-5-3-1;/h7-8H,4-6H2,1-3H3;1-5H;/q2*-1;+2 |
| InChIKey | ZXRAPWGSTOXXOF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|