C25H28Fe2-8 — CID 174912786
cyclopenta-1,3-diene;cyclopentane;iron;1-methyl-5-[1-(2-methylcyclopenta-2,4-dien-1-yl)propyl]cyclopenta-1,3-diene (PubChem CID 174912786) has the molecular formula C25H28Fe2-8 and a molecular weight of 440.19 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopentane;iron;1-methyl-5-[1-(2-methylcyclopenta-2,4-dien-1-yl)propyl]cyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,3-diene;cyclopentane;iron;1-methyl-5-[1-(2-methylcyclopenta-2,4-dien-1-yl)propyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 174912786 |
| Molecular Formula | C25H28Fe2-8 |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopentane;iron;1-methyl-5-[1-(2-methylcyclopenta-2,4-dien-1-yl)propyl]cyclopenta-1,3-diene |
| SMILES | CCC([c-]1cccc1C)[c-]1cccc1C.[Fe].[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.c1cc[cH-]c1 |
| InChI | InChI=1S/C15H18.2C5H5.2Fe/c1-4-13(14-9-5-7-11(14)2)15-10-6-8-12(15)3;2*1-2-4-5-3-1;;/h5-10,13H,4H2,1-3H3;2*1-5H;;/q-2;-5;-1;; |
| InChIKey | RIDVOWOLTWBADL-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|