C12H12FeIN3 — CID 139251617
5-[(1S)-1-azidoethyl]-1-iodocyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139251617) has the molecular formula C12H12FeIN3 and a molecular weight of 381.00 g/mol. Its IUPAC name is 5-[(1S)-1-azidoethyl]-1-iodocyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 5-[(1S)-1-azidoethyl]-1-iodocyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139251617 |
| Molecular Formula | C12H12FeIN3 |
| Molecular Weight | 381.00 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 5-[(1S)-1-azidoethyl]-1-iodocyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
| SMILES | C[C@H](N=[N+]=[N-])[c-]1cccc1I.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H7IN3.C5H5.Fe/c1-5(10-11-9)6-3-2-4-7(6)8;1-2-4-5-3-1;/h2-5H,1H3;1-5H;/q2*-1;+2/t5-;;/m0../s1 |
| InChIKey | ZPDWLIJZYNNEHD-XRIGFGBMSA-N |
| XLogP | 4.78 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.00 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|