C12H14FeIN — CID 131729052
cyclopenta-1,3-diene;5-iodo-N,N-dimethylcyclopenta-1,3-dien-1-amine;iron(2+) (PubChem CID 131729052) has the molecular formula C12H14FeIN and a molecular weight of 355.00 g/mol. Its IUPAC name is cyclopenta-1,3-diene;5-iodo-N,N-dimethylcyclopenta-1,3-dien-1-amine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;5-iodo-N,N-dimethylcyclopenta-1,3-dien-1-amine;iron(2+) |
|---|---|
| PubChem CID | 131729052 |
| Molecular Formula | C12H14FeIN |
| Molecular Weight | 355.00 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | cyclopenta-1,3-diene;5-iodo-N,N-dimethylcyclopenta-1,3-dien-1-amine;iron(2+) |
| SMILES | CN(C)c1ccc[c-]1I.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H9IN.C5H5.Fe/c1-9(2)7-5-3-4-6(7)8;1-2-4-5-3-1;/h3-5H,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | HUWDXTQMRISEEH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.00 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|