C12H15FeN — CID 172687333
cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,4-dien-1-amine;iron(2+) (PubChem CID 172687333) has the molecular formula C12H15FeN and a molecular weight of 229.10 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,4-dien-1-amine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,4-dien-1-amine;iron(2+) |
|---|---|
| PubChem CID | 172687333 |
| Molecular Formula | C12H15FeN |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,4-dien-1-amine;iron(2+) |
| SMILES | Cc1c(N)cc[c-]1C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H10N.C5H5.Fe/c1-5-3-4-7(8)6(5)2;1-2-4-5-3-1;/h3-4H,8H2,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | BFDOVLXHIWMNFN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|